C18H18ClF3NO4PS — CID 102358374
4-chloro-2-diethoxyphosphinothioyloxy-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 102358374) has the molecular formula C18H18ClF3NO4PS and a molecular weight of 467.83 g/mol. Its IUPAC name is 4-chloro-2-diethoxyphosphinothioyloxy-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-2-diethoxyphosphinothioyloxy-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 102358374 |
| Molecular Formula | C18H18ClF3NO4PS |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 4-chloro-2-diethoxyphosphinothioyloxy-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOP(=S)(OCC)Oc1cc(Cl)ccc1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18ClF3NO4PS/c1-3-25-28(29,26-4-2)27-16-11-13(19)7-10-15(16)17(24)23-14-8-5-12(6-9-14)18(20,21)22/h5-11H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | LBVJMPCZDOWRRB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|