C17H18Cl2NO5P — CID 73334324
[4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] diethyl phosphate (PubChem CID 73334324) has the molecular formula C17H18Cl2NO5P and a molecular weight of 418.21 g/mol. Its IUPAC name is [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] diethyl phosphate.
| Compound Name | [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] diethyl phosphate |
|---|---|
| PubChem CID | 73334324 |
| Molecular Formula | C17H18Cl2NO5P |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | [4-chloro-2-[(4-chlorophenyl)carbamoyl]phenyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1ccc(Cl)cc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2NO5P/c1-3-23-26(22,24-4-2)25-16-10-7-13(19)11-15(16)17(21)20-14-8-5-12(18)6-9-14/h5-11H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | DJTCVCJHIRXTQA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|