C16H12Cl2F3NO3S — CID 1489673
2,3-dichloro-4-ethylsulfonyl-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 1489673) has the molecular formula C16H12Cl2F3NO3S and a molecular weight of 426.24 g/mol. Its IUPAC name is 2,3-dichloro-4-ethylsulfonyl-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,3-dichloro-4-ethylsulfonyl-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1489673 |
| Molecular Formula | C16H12Cl2F3NO3S |
| Molecular Weight | 426.24 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2,3-dichloro-4-ethylsulfonyl-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl2F3NO3S/c1-2-26(24,25)12-8-7-11(13(17)14(12)18)15(23)22-10-5-3-9(4-6-10)16(19,20)21/h3-8H,2H2,1H3,(H,22,23) |
| InChIKey | HFMFPBBDXVCIFZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |