C22H13F6NO4 — CID 138748534
4-[[4-(trifluoromethyl)-2-[4-(trifluoromethyl)phenoxy]benzoyl]amino]benzoic acid (PubChem CID 138748534) has the molecular formula C22H13F6NO4 and a molecular weight of 469.34 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)-2-[4-(trifluoromethyl)phenoxy]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[4-(trifluoromethyl)-2-[4-(trifluoromethyl)phenoxy]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 138748534 |
| Molecular Formula | C22H13F6NO4 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 4-[[4-(trifluoromethyl)-2-[4-(trifluoromethyl)phenoxy]benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(C(F)(F)F)cc2Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H13F6NO4/c23-21(24,25)13-3-8-16(9-4-13)33-18-11-14(22(26,27)28)5-10-17(18)19(30)29-15-6-1-12(2-7-15)20(31)32/h1-11H,(H,29,30)(H,31,32) |
| InChIKey | JHTPZCWSLSDXPM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |