C23H14F4N2O2 — CID 53329942
2-fluoro-N-(4-quinolin-4-yloxyphenyl)-5-(trifluoromethyl)benzamide (PubChem CID 53329942) has the molecular formula C23H14F4N2O2 and a molecular weight of 426.37 g/mol. Its IUPAC name is 2-fluoro-N-(4-quinolin-4-yloxyphenyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(4-quinolin-4-yloxyphenyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 53329942 |
| Molecular Formula | C23H14F4N2O2 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-fluoro-N-(4-quinolin-4-yloxyphenyl)-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc3ccccc23)cc1)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C23H14F4N2O2/c24-19-10-5-14(23(25,26)27)13-18(19)22(30)29-15-6-8-16(9-7-15)31-21-11-12-28-20-4-2-1-3-17(20)21/h1-13H,(H,29,30) |
| InChIKey | HLQQFANMINGQAS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |