C13H7ClF4N2O — CID 103943594
N-(3-chloro-2-pyridinyl)-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 103943594) has the molecular formula C13H7ClF4N2O and a molecular weight of 318.66 g/mol. Its IUPAC name is N-(3-chloro-2-pyridinyl)-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(3-chloro-2-pyridinyl)-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103943594 |
| Molecular Formula | C13H7ClF4N2O |
| Molecular Weight | 318.66 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-(3-chloro-2-pyridinyl)-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ncccc1Cl)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H7ClF4N2O/c14-9-2-1-5-19-11(9)20-12(21)8-6-7(13(16,17)18)3-4-10(8)15/h1-6H,(H,19,20,21) |
| InChIKey | JLCWSJZTBIUTOX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |