C13H7F5N2O — CID 103874425
2-fluoro-N-(3-fluoro-4-pyridinyl)-5-(trifluoromethyl)benzamide (PubChem CID 103874425) has the molecular formula C13H7F5N2O and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-fluoro-N-(3-fluoro-4-pyridinyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(3-fluoro-4-pyridinyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103874425 |
| Molecular Formula | C13H7F5N2O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-fluoro-N-(3-fluoro-4-pyridinyl)-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccncc1F)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H7F5N2O/c14-9-2-1-7(13(16,17)18)5-8(9)12(21)20-11-3-4-19-6-10(11)15/h1-6H,(H,19,20,21) |
| InChIKey | WIYLNKVRIKLEKQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |