C13H7Cl2F3N2O — CID 66464004
3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 66464004) has the molecular formula C13H7Cl2F3N2O and a molecular weight of 335.11 g/mol. Its IUPAC name is 3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66464004 |
| Molecular Formula | C13H7Cl2F3N2O |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1ccncc1Cl |
| InChI | InChI=1S/C13H7Cl2F3N2O/c14-9-2-1-7(13(16,17)18)5-11(9)20-12(21)8-3-4-19-6-10(8)15/h1-6H,(H,20,21) |
| InChIKey | SOZUIBQBIQZXGM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |