C12H7ClF3N3O — CID 75508828
2-chloro-N-pyrazin-2-yl-4-(trifluoromethyl)benzamide (PubChem CID 75508828) has the molecular formula C12H7ClF3N3O and a molecular weight of 301.66 g/mol. Its IUPAC name is 2-chloro-N-pyrazin-2-yl-4-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-pyrazin-2-yl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 75508828 |
| Molecular Formula | C12H7ClF3N3O |
| Molecular Weight | 301.66 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-chloro-N-pyrazin-2-yl-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cnccn1)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H7ClF3N3O/c13-9-5-7(12(14,15)16)1-2-8(9)11(20)19-10-6-17-3-4-18-10/h1-6H,(H,18,19,20) |
| InChIKey | GWGWRZUBUVTGDC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |