C13H7Cl5N2O — CID 15156845
2,4-dichloro-N-[4-(trichloromethyl)-2-pyridinyl]benzamide (PubChem CID 15156845) has the molecular formula C13H7Cl5N2O and a molecular weight of 384.48 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(trichloromethyl)-2-pyridinyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(trichloromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 15156845 |
| Molecular Formula | C13H7Cl5N2O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | 2,4-dichloro-N-[4-(trichloromethyl)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1cc(C(Cl)(Cl)Cl)ccn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl5N2O/c14-8-1-2-9(10(15)6-8)12(21)20-11-5-7(3-4-19-11)13(16,17)18/h1-6H,(H,19,20,21) |
| InChIKey | JBXLGFXWGCFVQJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|