C14H14Cl2N2O2 — CID 17173901
N-(5-tert-butyl-1,2-oxazol-3-yl)-2,4-dichlorobenzamide (PubChem CID 17173901) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-2,4-dichlorobenzamide.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 17173901 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2,4-dichlorobenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-14(2,3)11-7-12(18-20-11)17-13(19)9-5-4-8(15)6-10(9)16/h4-7H,1-3H3,(H,17,18,19) |
| InChIKey | TZFLFPRRNQJNAA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |