C16H18Cl2N2O3 — CID 35524710
(2R)-N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 35524710) has the molecular formula C16H18Cl2N2O3 and a molecular weight of 357.24 g/mol. Its IUPAC name is (2R)-N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2R)-N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 35524710 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (2R)-N-(5-tert-butyl-1,2-oxazol-3-yl)-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C16H18Cl2N2O3/c1-9(22-12-6-5-10(17)7-11(12)18)15(21)19-14-8-13(23-20-14)16(2,3)4/h5-9H,1-4H3,(H,19,20,21)/t9-/m1/s1 |
| InChIKey | WXEQVUBUFRPKKL-SECBINFHSA-N |
| XLogP | 4.68 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |