C15H13Cl2IN2O2 — CID 2233489
(2S)-2-(2,4-dichlorophenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)propanamide (PubChem CID 2233489) has the molecular formula C15H13Cl2IN2O2 and a molecular weight of 451.09 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 2233489 |
| Molecular Formula | C15H13Cl2IN2O2 |
| Molecular Weight | 451.09 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-(5-iodo-6-methyl-2-pyridinyl)propanamide |
| SMILES | Cc1nc(NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)ccc1I |
| InChI | InChI=1S/C15H13Cl2IN2O2/c1-8-12(18)4-6-14(19-8)20-15(21)9(2)22-13-5-3-10(16)7-11(13)17/h3-7,9H,1-2H3,(H,19,20,21)/t9-/m0/s1 |
| InChIKey | VMQGYOVPZFZOQZ-VIFPVBQESA-N |
| XLogP | 4.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.09 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|