C13H9Cl4N3O2 — CID 141112918
2-(2,4-dichlorophenoxy)-N-(4,6-dichloropyrimidin-2-yl)propanamide (PubChem CID 141112918) has the molecular formula C13H9Cl4N3O2 and a molecular weight of 381.05 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4,6-dichloropyrimidin-2-yl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4,6-dichloropyrimidin-2-yl)propanamide |
|---|---|
| PubChem CID | 141112918 |
| Molecular Formula | C13H9Cl4N3O2 |
| Molecular Weight | 381.05 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4,6-dichloropyrimidin-2-yl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C13H9Cl4N3O2/c1-6(22-9-3-2-7(14)4-8(9)15)12(21)20-13-18-10(16)5-11(17)19-13/h2-6H,1H3,(H,18,19,20,21) |
| InChIKey | BGWCKTJDEMMGKZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.05 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |