C14H11Cl3N2O2 — CID 2939243
N-(5-chloro-2-pyridinyl)-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 2939243) has the molecular formula C14H11Cl3N2O2 and a molecular weight of 345.61 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 2939243 |
| Molecular Formula | C14H11Cl3N2O2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H11Cl3N2O2/c1-8(21-12-4-2-9(15)6-11(12)17)14(20)19-13-5-3-10(16)7-18-13/h2-8H,1H3,(H,18,19,20) |
| InChIKey | VBYYBXDZKLOTCZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |