C18H26ClN3O2S — CID 143852097
N-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-2-(methylamino)propanamide;4-chlorobenzenethiol (PubChem CID 143852097) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-2-(methylamino)propanamide;4-chlorobenzenethiol.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-2-(methylamino)propanamide;4-chlorobenzenethiol |
|---|---|
| PubChem CID | 143852097 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2-methyl-2-(methylamino)propanamide;4-chlorobenzenethiol |
| SMILES | CNC(C)(C)C(=O)Nc1cc(C(C)(C)C)on1.Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H21N3O2.C6H5ClS/c1-11(2,3)8-7-9(15-17-8)14-10(16)12(4,5)13-6;7-5-1-3-6(8)4-2-5/h7,13H,1-6H3,(H,14,15,16);1-4,8H |
| InChIKey | KIQNWJLUNOSURF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|