C16H16Cl2N2O — CID 110443054
N-(2-tert-butyl-4-pyridinyl)-2,4-dichlorobenzamide (PubChem CID 110443054) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is N-(2-tert-butyl-4-pyridinyl)-2,4-dichlorobenzamide.
| Compound Name | N-(2-tert-butyl-4-pyridinyl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 110443054 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-(2-tert-butyl-4-pyridinyl)-2,4-dichlorobenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc(Cl)cc2Cl)ccn1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-16(2,3)14-9-11(6-7-19-14)20-15(21)12-5-4-10(17)8-13(12)18/h4-9H,1-3H3,(H,19,20,21) |
| InChIKey | ZBWIBKOTUHYONU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |