C19H19Cl2NO3 — CID 122188993
[2-tert-butyl-4-[(2,4-dichlorobenzoyl)amino]phenyl] acetate (PubChem CID 122188993) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is [2-tert-butyl-4-[(2,4-dichlorobenzoyl)amino]phenyl] acetate.
| Compound Name | [2-tert-butyl-4-[(2,4-dichlorobenzoyl)amino]phenyl] acetate |
|---|---|
| PubChem CID | 122188993 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-tert-butyl-4-[(2,4-dichlorobenzoyl)amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1C(C)(C)C |
| InChI | InChI=1S/C19H19Cl2NO3/c1-11(23)25-17-8-6-13(10-15(17)19(2,3)4)22-18(24)14-7-5-12(20)9-16(14)21/h5-10H,1-4H3,(H,22,24) |
| InChIKey | PDUAMMSKAKDSKY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|