C16H20N2O4 — CID 35281552
N-(5-tert-butyl-1,2-oxazol-3-yl)-2,3-dimethoxybenzamide (PubChem CID 35281552) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(5-tert-butyl-1,2-oxazol-3-yl)-2,3-dimethoxybenzamide.
| Compound Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 35281552 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(5-tert-butyl-1,2-oxazol-3-yl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cc(C(C)(C)C)on2)c1OC |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,3)12-9-13(18-22-12)17-15(19)10-7-6-8-11(20-4)14(10)21-5/h6-9H,1-5H3,(H,17,18,19) |
| InChIKey | VYSYNSAYAGTHEI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |