C14H14ClFN2O2 — CID 73051560
5-tert-butyl-N-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 73051560) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 5-tert-butyl-N-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 73051560 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-tert-butyl-N-(3-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccc(F)c(Cl)c2)no1 |
| InChI | InChI=1S/C14H14ClFN2O2/c1-14(2,3)12-7-11(18-20-12)13(19)17-8-4-5-10(16)9(15)6-8/h4-7H,1-3H3,(H,17,19) |
| InChIKey | MHACFZWEKUXCNT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |