C20H15Cl2N3O2 — CID 1339954
2,4-dichloro-N-[2-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide (PubChem CID 1339954) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 1339954 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2,4-dichloro-N-[2-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]benzamide |
| SMILES | Cc1ccnc(NC(=O)c2ccccc2NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H15Cl2N3O2/c1-12-8-9-23-18(10-12)25-20(27)15-4-2-3-5-17(15)24-19(26)14-7-6-13(21)11-16(14)22/h2-11H,1H3,(H,24,26)(H,23,25,27) |
| InChIKey | UTOCLGWSZSUBCR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |