C28H20Cl2N2O3 — CID 2342128
N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2,4-dichlorobenzamide (PubChem CID 2342128) has the molecular formula C28H20Cl2N2O3 and a molecular weight of 503.39 g/mol. Its IUPAC name is N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2342128 |
| Molecular Formula | C28H20Cl2N2O3 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2,4-dichlorobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(Cl)cc2Cl)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H20Cl2N2O3/c1-17-11-14-25(22(15-17)26(33)18-7-3-2-4-8-18)32-28(35)21-9-5-6-10-24(21)31-27(34)20-13-12-19(29)16-23(20)30/h2-16H,1H3,(H,31,34)(H,32,35) |
| InChIKey | YZHXUKPTFACHCX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |