C20H12ClF2NO2 — CID 992682
N-(2-benzoylphenyl)-2-chloro-4,5-difluorobenzamide (PubChem CID 992682) has the molecular formula C20H12ClF2NO2 and a molecular weight of 371.77 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-(2-benzoylphenyl)-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 992682 |
| Molecular Formula | C20H12ClF2NO2 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-(2-benzoylphenyl)-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(Nc1ccccc1C(=O)c1ccccc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H12ClF2NO2/c21-15-11-17(23)16(22)10-14(15)20(26)24-18-9-5-4-8-13(18)19(25)12-6-2-1-3-7-12/h1-11H,(H,24,26) |
| InChIKey | GRYOUZMUIPLMRI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|