C20H13F2NO2 — CID 70149608
2-benzoyl-4,5-difluoro-N-phenylbenzamide (PubChem CID 70149608) has the molecular formula C20H13F2NO2 and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-benzoyl-4,5-difluoro-N-phenylbenzamide.
| Compound Name | 2-benzoyl-4,5-difluoro-N-phenylbenzamide |
|---|---|
| PubChem CID | 70149608 |
| Molecular Formula | C20H13F2NO2 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-benzoyl-4,5-difluoro-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cc(F)c(F)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H13F2NO2/c21-17-11-15(19(24)13-7-3-1-4-8-13)16(12-18(17)22)20(25)23-14-9-5-2-6-10-14/h1-12H,(H,23,25) |
| InChIKey | QIAUVPSRLVFBRE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |