C22H18N4O4 — CID 141129125
4,6-dibenzoylbenzene-1,3-dicarbohydrazide (PubChem CID 141129125) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 4,6-dibenzoylbenzene-1,3-dicarbohydrazide.
| Compound Name | 4,6-dibenzoylbenzene-1,3-dicarbohydrazide |
|---|---|
| PubChem CID | 141129125 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4,6-dibenzoylbenzene-1,3-dicarbohydrazide |
| SMILES | NNC(=O)c1cc(C(=O)NN)c(C(=O)c2ccccc2)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O4/c23-25-21(29)17-12-18(22(30)26-24)16(20(28)14-9-5-2-6-10-14)11-15(17)19(27)13-7-3-1-4-8-13/h1-12H,23-24H2,(H,25,29)(H,26,30) |
| InChIKey | PRHJIONOOSMHEW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|