C15H17N3O2 — CID 23331712
2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)acetohydrazide (PubChem CID 23331712) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)acetohydrazide.
| Compound Name | 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 23331712 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)acetohydrazide |
| SMILES | Cc1cc(C(=O)c2ccccc2)c(C)n1CC(=O)NN |
| InChI | InChI=1S/C15H17N3O2/c1-10-8-13(11(2)18(10)9-14(19)17-16)15(20)12-6-4-3-5-7-12/h3-8H,9,16H2,1-2H3,(H,17,19) |
| InChIKey | DYEOMAHIFYHDJT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|