About (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone
(5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone (PubChem CID 827958) has the molecular formula C21H17NO2
and a molecular weight of 315.37 g/mol. Its IUPAC name is (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone.
Molecular Properties
| Compound Name | (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone |
| PubChem CID | 827958 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone |
| SMILES | Cc1nc(C)c(C(=O)c2ccccc2)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17NO2/c1-14-18(20(23)16-9-5-3-6-10-16)13-19(15(2)22-14)21(24)17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | ADHDLDUKQXDATR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone?
The IUPAC name of (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone (CID 827958) is (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone.
What is the SMILES notation for (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone?
The canonical SMILES for (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone is Cc1nc(C)c(C(=O)c2ccccc2)cc1C(=O)c1ccccc1.
What is the InChIKey of (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone?
The InChIKey is ADHDLDUKQXDATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2/c1-14-18(20(23)16-9-5-3-6-10-16)13-19(15(2)22-14)21(24)17-11-7-4-8-12-17/h3-13H,1-2H3.
What are the key properties of (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone?
(5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone has a molecular weight of 315.37 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzoyl-2,6-dimethyl-3-pyridinyl)-phenylmethanone is sourced from PubChem (CID 827958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).