C15H14O2 — CID 19026877
(4-hydroxy-2,5-dimethylphenyl)-phenylmethanone (PubChem CID 19026877) has the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (4-hydroxy-2,5-dimethylphenyl)-phenylmethanone.
| Compound Name | (4-hydroxy-2,5-dimethylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 19026877 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (4-hydroxy-2,5-dimethylphenyl)-phenylmethanone |
| SMILES | Cc1cc(C(=O)c2ccccc2)c(C)cc1O |
| InChI | InChI=1S/C15H14O2/c1-10-9-14(16)11(2)8-13(10)15(17)12-6-4-3-5-7-12/h3-9,16H,1-2H3 |
| InChIKey | MDWWYJXDIMXLHU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |