C22H18O2 — CID 90191697
[3-(2,5-dimethylbenzoyl)phenyl]-phenylmethanone (PubChem CID 90191697) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is [3-(2,5-dimethylbenzoyl)phenyl]-phenylmethanone.
| Compound Name | [3-(2,5-dimethylbenzoyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 90191697 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [3-(2,5-dimethylbenzoyl)phenyl]-phenylmethanone |
| SMILES | Cc1ccc(C)c(C(=O)c2cccc(C(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C22H18O2/c1-15-11-12-16(2)20(13-15)22(24)19-10-6-9-18(14-19)21(23)17-7-4-3-5-8-17/h3-14H,1-2H3 |
| InChIKey | VJCCKVTYTWNYNP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |