C30H30N2O2 — CID 70126178
(2-amino-3,5-dimethylphenyl)-phenylmethanone (PubChem CID 70126178) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is (2-amino-3,5-dimethylphenyl)-phenylmethanone.
| Compound Name | (2-amino-3,5-dimethylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 70126178 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (2-amino-3,5-dimethylphenyl)-phenylmethanone |
| SMILES | Cc1cc(C)c(N)c(C(=O)c2ccccc2)c1.Cc1cc(C)c(N)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/2C15H15NO/c2*1-10-8-11(2)14(16)13(9-10)15(17)12-6-4-3-5-7-12/h2*3-9H,16H2,1-2H3 |
| InChIKey | BFNZOTIQUHWJLM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|