C17H15N3O — CID 10912819
(4-amino-6,8-dimethylcinnolin-3-yl)-phenylmethanone (PubChem CID 10912819) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is (4-amino-6,8-dimethylcinnolin-3-yl)-phenylmethanone.
| Compound Name | (4-amino-6,8-dimethylcinnolin-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 10912819 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (4-amino-6,8-dimethylcinnolin-3-yl)-phenylmethanone |
| SMILES | Cc1cc(C)c2nnc(C(=O)c3ccccc3)c(N)c2c1 |
| InChI | InChI=1S/C17H15N3O/c1-10-8-11(2)15-13(9-10)14(18)16(20-19-15)17(21)12-6-4-3-5-7-12/h3-9H,1-2H3,(H2,18,19) |
| InChIKey | STNMRIAVXKMRCS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |