C14H13NO — CID 12954070
(2,5-dimethyl-4-pyridinyl)-phenylmethanone (PubChem CID 12954070) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is (2,5-dimethyl-4-pyridinyl)-phenylmethanone.
| Compound Name | (2,5-dimethyl-4-pyridinyl)-phenylmethanone |
|---|---|
| PubChem CID | 12954070 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2,5-dimethyl-4-pyridinyl)-phenylmethanone |
| SMILES | Cc1cc(C(=O)c2ccccc2)c(C)cn1 |
| InChI | InChI=1S/C14H13NO/c1-10-9-15-11(2)8-13(10)14(16)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | MICXARLNSHFBSX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |