C23H22N2O — CID 72700948
[2-[(2,4-dimethylphenyl)diazenyl]-3,5-dimethylphenyl]-phenylmethanone (PubChem CID 72700948) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)diazenyl]-3,5-dimethylphenyl]-phenylmethanone.
| Compound Name | [2-[(2,4-dimethylphenyl)diazenyl]-3,5-dimethylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 72700948 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)diazenyl]-3,5-dimethylphenyl]-phenylmethanone |
| SMILES | Cc1ccc(/N=N/c2c(C)cc(C)cc2C(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H22N2O/c1-15-10-11-21(17(3)12-15)24-25-22-18(4)13-16(2)14-20(22)23(26)19-8-6-5-7-9-19/h5-14H,1-4H3/b25-24+ |
| InChIKey | UZUSTBSYEMGULK-OCOZRVBESA-N |
| XLogP | 6.57 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|