C27H25N3O2 — CID 135698143
N-[7-[(2,4-dimethylphenyl)diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-1-yl]benzamide (PubChem CID 135698143) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[7-[(2,4-dimethylphenyl)diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-1-yl]benzamide.
| Compound Name | N-[7-[(2,4-dimethylphenyl)diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 135698143 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[7-[(2,4-dimethylphenyl)diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-1-yl]benzamide |
| SMILES | Cc1ccc(/N=N/c2c(C)cc3cc(C)cc(NC(=O)c4ccccc4)c3c2O)c(C)c1 |
| InChI | InChI=1S/C27H25N3O2/c1-16-10-11-22(18(3)12-16)29-30-25-19(4)15-21-13-17(2)14-23(24(21)26(25)31)28-27(32)20-8-6-5-7-9-20/h5-15,31H,1-4H3,(H,28,32)/b30-29+ |
| InChIKey | YUUVQRWVDJVUGA-QVIHXGFCSA-N |
| XLogP | 7.45 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|