C26H23N3O5S — CID 135854936
5-benzamido-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-8-methylnaphthalene-2-sulfonic acid (PubChem CID 135854936) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is 5-benzamido-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-8-methylnaphthalene-2-sulfonic acid.
| Compound Name | 5-benzamido-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-8-methylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135854936 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 5-benzamido-3-[(2,5-dimethylphenyl)diazenyl]-4-hydroxy-8-methylnaphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(C)c(/N=N/c2c(S(=O)(=O)O)cc3c(C)ccc(NC(=O)c4ccccc4)c3c2O)c1 |
| InChI | InChI=1S/C26H23N3O5S/c1-15-9-10-17(3)21(13-15)28-29-24-22(35(32,33)34)14-19-16(2)11-12-20(23(19)25(24)30)27-26(31)18-7-5-4-6-8-18/h4-14,30H,1-3H3,(H,27,31)(H,32,33,34)/b29-28+ |
| InChIKey | BZGLLZJHJUAWHZ-ZQHSETAFSA-N |
| XLogP | 6.39 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|