C23H18N4O11S3 — CID 135753287
3-[(5-amino-2-sulfophenyl)diazenyl]-5-benzamido-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 135753287) has the molecular formula C23H18N4O11S3 and a molecular weight of 622.62 g/mol. Its IUPAC name is 3-[(5-amino-2-sulfophenyl)diazenyl]-5-benzamido-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(5-amino-2-sulfophenyl)diazenyl]-5-benzamido-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135753287 |
| Molecular Formula | C23H18N4O11S3 |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.01 |
| IUPAC Name | 3-[(5-amino-2-sulfophenyl)diazenyl]-5-benzamido-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(NC(=O)c4ccccc4)c3c2O)c1 |
| InChI | InChI=1S/C23H18N4O11S3/c24-14-6-7-18(40(33,34)35)16(10-14)26-27-21-19(41(36,37)38)9-13-8-15(39(30,31)32)11-17(20(13)22(21)28)25-23(29)12-4-2-1-3-5-12/h1-11,28H,24H2,(H,25,29)(H,30,31,32)(H,33,34,35)(H,36,37,38)/b27-26+ |
| InChIKey | FEPBHKRVKRRCOU-CYYJNZCTSA-N |
| XLogP | 3.54 |
| TPSA | 263.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|