C34H30N4O16S5 — CID 135755774
5-[3-(benzenesulfonyl)propanoylamino]-3-[[4-[3-(benzenesulfonyl)propanoylamino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 135755774) has the molecular formula C34H30N4O16S5 and a molecular weight of 910.96 g/mol. Its IUPAC name is 5-[3-(benzenesulfonyl)propanoylamino]-3-[[4-[3-(benzenesulfonyl)propanoylamino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-[3-(benzenesulfonyl)propanoylamino]-3-[[4-[3-(benzenesulfonyl)propanoylamino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135755774 |
| Molecular Formula | C34H30N4O16S5 |
| Molecular Weight | 910.96 g/mol |
| Exact Mass | 910.03 |
| IUPAC Name | 5-[3-(benzenesulfonyl)propanoylamino]-3-[[4-[3-(benzenesulfonyl)propanoylamino]-2-sulfophenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(NC(=O)CCS(=O)(=O)c4ccccc4)c3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C34H30N4O16S5/c39-30(13-15-55(42,43)23-7-3-1-4-8-23)35-22-11-12-26(28(19-22)58(49,50)51)37-38-33-29(59(52,53)54)18-21-17-25(57(46,47)48)20-27(32(21)34(33)41)36-31(40)14-16-56(44,45)24-9-5-2-6-10-24/h1-12,17-20,41H,13-16H2,(H,35,39)(H,36,40)(H,46,47,48)(H,49,50,51)(H,52,53,54)/b38-37+ |
| InChIKey | ARRRNFBWXZZVSZ-HEFFKOSUSA-N |
| XLogP | 4.31 |
| TPSA | 334.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|