C24H21N3O13S4 — CID 136835097
4-hydroxy-5-[3-(2-hydroxyethylsulfonyl)anilino]-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136835097) has the molecular formula C24H21N3O13S4 and a molecular weight of 687.71 g/mol. Its IUPAC name is 4-hydroxy-5-[3-(2-hydroxyethylsulfonyl)anilino]-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-[3-(2-hydroxyethylsulfonyl)anilino]-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136835097 |
| Molecular Formula | C24H21N3O13S4 |
| Molecular Weight | 687.71 g/mol |
| Exact Mass | 687.00 |
| IUPAC Name | 4-hydroxy-5-[3-(2-hydroxyethylsulfonyl)anilino]-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Nc2cccc(S(=O)(=O)CCO)c2)c2c(O)c(/N=N/c3ccccc3S(=O)(=O)O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C24H21N3O13S4/c28-8-9-41(30,31)16-5-3-4-15(12-16)25-19-13-17(42(32,33)34)10-14-11-21(44(38,39)40)23(24(29)22(14)19)27-26-18-6-1-2-7-20(18)43(35,36)37/h1-7,10-13,25,28-29H,8-9H2,(H,32,33,34)(H,35,36,37)(H,38,39,40)/b27-26+ |
| InChIKey | UVWNCNBSHAQTRA-CYYJNZCTSA-N |
| XLogP | 3.21 |
| TPSA | 274.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|