C25H30N4O11S3 — CID 135730778
5-acetamido-3-[[5-[2-(diethylamino)ethylsulfonyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 135730778) has the molecular formula C25H30N4O11S3 and a molecular weight of 658.73 g/mol. Its IUPAC name is 5-acetamido-3-[[5-[2-(diethylamino)ethylsulfonyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-acetamido-3-[[5-[2-(diethylamino)ethylsulfonyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135730778 |
| Molecular Formula | C25H30N4O11S3 |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.11 |
| IUPAC Name | 5-acetamido-3-[[5-[2-(diethylamino)ethylsulfonyl]-2-methoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CCN(CC)CCS(=O)(=O)c1ccc(OC)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(NC(C)=O)c3c2O)c1 |
| InChI | InChI=1S/C25H30N4O11S3/c1-5-29(6-2)9-10-41(32,33)17-7-8-21(40-4)19(13-17)27-28-24-22(43(37,38)39)12-16-11-18(42(34,35)36)14-20(26-15(3)30)23(16)25(24)31/h7-8,11-14,31H,5-6,9-10H2,1-4H3,(H,26,30)(H,34,35,36)(H,37,38,39)/b28-27+ |
| InChIKey | NRILTZBAKSFHLV-BYYHNAKLSA-N |
| XLogP | 3.54 |
| TPSA | 229.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|