C21H19N3Na2O12S3 — CID 102269607
disodium;N-[7-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate (PubChem CID 102269607) has the molecular formula C21H19N3Na2O12S3 and a molecular weight of 647.57 g/mol. Its IUPAC name is disodium;N-[7-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate.
| Compound Name | disodium;N-[7-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate |
|---|---|
| PubChem CID | 102269607 |
| Molecular Formula | C21H19N3Na2O12S3 |
| Molecular Weight | 647.57 g/mol |
| Exact Mass | 646.99 |
| IUPAC Name | disodium;N-[7-[[5-(2-hydroxyethylsulfonyl)-2-methoxyphenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate |
| SMILES | COc1ccc(S(=O)(=O)CCO)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(/N=C(\C)[O-])c2c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H21N3O12S3.2Na/c1-11(26)22-16-10-14(38(30,31)32)7-12-8-18(39(33,34)35)20(21(27)19(12)16)24-23-15-9-13(3-4-17(15)36-2)37(28,29)6-5-25;;/h3-4,7-10,25,27H,5-6H2,1-2H3,(H,22,26)(H,30,31,32)(H,33,34,35);;/q;2*+1/p-2/b24-23+;; |
| InChIKey | UGAAQFFNUPHXMI-KPOOZVEVSA-L |
| XLogP | -4.99 |
| TPSA | 255.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.57 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|