C35H29N3Na2O9S2 — CID 102269301
disodium;N-[7-[[2-(2-cyclohexylphenoxy)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]benzenecarboximidate (PubChem CID 102269301) has the molecular formula C35H29N3Na2O9S2 and a molecular weight of 745.74 g/mol. Its IUPAC name is disodium;N-[7-[[2-(2-cyclohexylphenoxy)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]benzenecarboximidate.
| Compound Name | disodium;N-[7-[[2-(2-cyclohexylphenoxy)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 102269301 |
| Molecular Formula | C35H29N3Na2O9S2 |
| Molecular Weight | 745.74 g/mol |
| Exact Mass | 745.11 |
| IUPAC Name | disodium;N-[7-[[2-(2-cyclohexylphenoxy)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]benzenecarboximidate |
| SMILES | O=S(=O)(O)c1cc(/N=C(\[O-])c2ccccc2)c2c([O-])c(/N=N/c3ccccc3Oc3ccccc3C3CCCCC3)c(S(=O)(=O)O)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C35H31N3O9S2.2Na/c39-34-32-24(19-25(48(41,42)43)21-28(32)36-35(40)23-13-5-2-6-14-23)20-31(49(44,45)46)33(34)38-37-27-16-8-10-18-30(27)47-29-17-9-7-15-26(29)22-11-3-1-4-12-22;;/h2,5-10,13-22,39H,1,3-4,11-12H2,(H,36,40)(H,41,42,43)(H,44,45,46);;/q;2*+1/p-2/b38-37+;; |
| InChIKey | KQTYMFGDOQCFRT-XPPIURIRSA-L |
| XLogP | 1.11 |
| TPSA | 201.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.74 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|