C25H20N4Na2O10S3 — CID 102058759
disodium;N-[7-[[2-methyl-5-(phenylsulfamoyl)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate (PubChem CID 102058759) has the molecular formula C25H20N4Na2O10S3 and a molecular weight of 678.63 g/mol. Its IUPAC name is disodium;N-[7-[[2-methyl-5-(phenylsulfamoyl)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate.
| Compound Name | disodium;N-[7-[[2-methyl-5-(phenylsulfamoyl)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate |
|---|---|
| PubChem CID | 102058759 |
| Molecular Formula | C25H20N4Na2O10S3 |
| Molecular Weight | 678.63 g/mol |
| Exact Mass | 678.01 |
| IUPAC Name | disodium;N-[7-[[2-methyl-5-(phenylsulfamoyl)phenyl]diazenyl]-8-oxido-3,6-disulfonaphthalen-1-yl]ethanimidate |
| SMILES | C/C([O-])=N\c1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3cc(S(=O)(=O)Nc4ccccc4)ccc3C)c([O-])c12.[Na+].[Na+] |
| InChI | InChI=1S/C25H22N4O10S3.2Na/c1-14-8-9-18(40(32,33)29-17-6-4-3-5-7-17)12-20(14)27-28-24-22(42(37,38)39)11-16-10-19(41(34,35)36)13-21(26-15(2)30)23(16)25(24)31;;/h3-13,29,31H,1-2H3,(H,26,30)(H,34,35,36)(H,37,38,39);;/q;2*+1/p-2/b28-27+;; |
| InChIKey | RTRHLOYNAHGFKB-JZYARHMISA-L |
| XLogP | -2.65 |
| TPSA | 238.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.63 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|