C34H25N7Na2O8S2 — CID 170840775
disodium;8-amino-2-[[4-[4-[(4-anilino-2-oxidophenyl)diazenyl]anilino]phenyl]diazenyl]-3,6-disulfonaphthalen-1-olate (PubChem CID 170840775) has the molecular formula C34H25N7Na2O8S2 and a molecular weight of 769.73 g/mol. Its IUPAC name is disodium;8-amino-2-[[4-[4-[(4-anilino-2-oxidophenyl)diazenyl]anilino]phenyl]diazenyl]-3,6-disulfonaphthalen-1-olate.
| Compound Name | disodium;8-amino-2-[[4-[4-[(4-anilino-2-oxidophenyl)diazenyl]anilino]phenyl]diazenyl]-3,6-disulfonaphthalen-1-olate |
|---|---|
| PubChem CID | 170840775 |
| Molecular Formula | C34H25N7Na2O8S2 |
| Molecular Weight | 769.73 g/mol |
| Exact Mass | 769.10 |
| IUPAC Name | disodium;8-amino-2-[[4-[4-[(4-anilino-2-oxidophenyl)diazenyl]anilino]phenyl]diazenyl]-3,6-disulfonaphthalen-1-olate |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(Nc4ccc(/N=N/c5ccc(Nc6ccccc6)cc5[O-])cc4)cc3)c([O-])c12.[Na+].[Na+] |
| InChI | InChI=1S/C34H27N7O8S2.2Na/c35-28-19-27(50(44,45)46)16-20-17-31(51(47,48)49)33(34(43)32(20)28)41-39-25-12-8-23(9-13-25)36-22-6-10-24(11-7-22)38-40-29-15-14-26(18-30(29)42)37-21-4-2-1-3-5-21;;/h1-19,36-37,42-43H,35H2,(H,44,45,46)(H,47,48,49);;/q;2*+1/p-2/b40-38+,41-39+;; |
| InChIKey | PTTMKBGMYTUTGN-ICUBATCWSA-L |
| XLogP | 1.39 |
| TPSA | 254.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|