C27H27N3O13S4 — CID 136785074
4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)-2-methoxy-5-methylphenyl]diazenyl]-5-[(4-methylphenyl)sulfonylamino]naphthalene-2,7-disulfonic acid (PubChem CID 136785074) has the molecular formula C27H27N3O13S4 and a molecular weight of 729.79 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)-2-methoxy-5-methylphenyl]diazenyl]-5-[(4-methylphenyl)sulfonylamino]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)-2-methoxy-5-methylphenyl]diazenyl]-5-[(4-methylphenyl)sulfonylamino]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136785074 |
| Molecular Formula | C27H27N3O13S4 |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.04 |
| IUPAC Name | 4-hydroxy-3-[[4-(2-hydroxyethylsulfonyl)-2-methoxy-5-methylphenyl]diazenyl]-5-[(4-methylphenyl)sulfonylamino]naphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(S(=O)(=O)CCO)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(NS(=O)(=O)c3ccc(C)cc3)c2c1O |
| InChI | InChI=1S/C27H27N3O13S4/c1-15-4-6-18(7-5-15)45(35,36)30-21-13-19(46(37,38)39)11-17-12-24(47(40,41)42)26(27(32)25(17)21)29-28-20-10-16(2)23(14-22(20)43-3)44(33,34)9-8-31/h4-7,10-14,30-32H,8-9H2,1-3H3,(H,37,38,39)(H,40,41,42)/b29-28+ |
| InChIKey | SCDMWLAMGUPAQQ-ZQHSETAFSA-N |
| XLogP | 3.65 |
| TPSA | 263.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|