C30H23N3Na2O11S4 — CID 136897509
disodium;4-hydroxy-5-[(4-methylphenyl)sulfonylamino]-3-[[4-(4-methylphenyl)sulfonylphenyl]diazenyl]naphthalene-2,7-disulfonate (PubChem CID 136897509) has the molecular formula C30H23N3Na2O11S4 and a molecular weight of 775.77 g/mol. Its IUPAC name is disodium;4-hydroxy-5-[(4-methylphenyl)sulfonylamino]-3-[[4-(4-methylphenyl)sulfonylphenyl]diazenyl]naphthalene-2,7-disulfonate.
| Compound Name | disodium;4-hydroxy-5-[(4-methylphenyl)sulfonylamino]-3-[[4-(4-methylphenyl)sulfonylphenyl]diazenyl]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 136897509 |
| Molecular Formula | C30H23N3Na2O11S4 |
| Molecular Weight | 775.77 g/mol |
| Exact Mass | 775.00 |
| IUPAC Name | disodium;4-hydroxy-5-[(4-methylphenyl)sulfonylamino]-3-[[4-(4-methylphenyl)sulfonylphenyl]diazenyl]naphthalene-2,7-disulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])c(/N=N/c4ccc(S(=O)(=O)c5ccc(C)cc5)cc4)c(O)c23)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C30H25N3O11S4.2Na/c1-18-3-9-22(10-4-18)45(35,36)23-13-7-21(8-14-23)31-32-29-27(48(42,43)44)16-20-15-25(47(39,40)41)17-26(28(20)30(29)34)33-46(37,38)24-11-5-19(2)6-12-24;;/h3-17,33-34H,1-2H3,(H,39,40,41)(H,42,43,44);;/q;2*+1/p-2/b32-31+;; |
| InChIKey | MBLMGMYRUNGCFG-GLDAUVFXSA-L |
| XLogP | -0.97 |
| TPSA | 239.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.77 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|