C24H15N3Na2O7S3 — CID 136632963
disodium;4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,6-disulfonate (PubChem CID 136632963) has the molecular formula C24H15N3Na2O7S3 and a molecular weight of 599.58 g/mol. Its IUPAC name is disodium;4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,6-disulfonate.
| Compound Name | disodium;4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,6-disulfonate |
|---|---|
| PubChem CID | 136632963 |
| Molecular Formula | C24H15N3Na2O7S3 |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 598.99 |
| IUPAC Name | disodium;4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,6-disulfonate |
| SMILES | Cc1ccc2nc(-c3ccc(/N=N/c4c(S(=O)(=O)[O-])cc5ccc(S(=O)(=O)[O-])cc5c4O)cc3)sc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C24H17N3O7S3.2Na/c1-13-2-9-19-20(10-13)35-24(25-19)14-3-6-16(7-4-14)26-27-22-21(37(32,33)34)11-15-5-8-17(36(29,30)31)12-18(15)23(22)28;;/h2-12,28H,1H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2/b27-26+;; |
| InChIKey | KTFMZTPHYYOOPV-YOYNBWDYSA-L |
| XLogP | -0.64 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|