C26H21N3NaO8S3+ — CID 165415555
sodium 5-ethoxy-4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 165415555) has the molecular formula C26H21N3NaO8S3+ and a molecular weight of 622.66 g/mol. Its IUPAC name is sodium 5-ethoxy-4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | sodium 5-ethoxy-4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 165415555 |
| Molecular Formula | C26H21N3NaO8S3+ |
| Molecular Weight | 622.66 g/mol |
| Exact Mass | 622.04 |
| IUPAC Name | sodium 5-ethoxy-4-hydroxy-3-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | CCOc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4nc5ccc(C)cc5s4)cc3)c(O)c12.[Na+] |
| InChI | InChI=1S/C26H21N3O8S3.Na/c1-3-37-20-13-18(39(31,32)33)11-16-12-22(40(34,35)36)24(25(30)23(16)20)29-28-17-7-5-15(6-8-17)26-27-19-9-4-14(2)10-21(19)38-26;/h4-13,30H,3H2,1-2H3,(H,31,32,33)(H,34,35,36);/q;+1/b29-28+; |
| InChIKey | YDKLHNUEQRDVIP-IRWWKPKRSA-N |
| XLogP | 3.44 |
| TPSA | 175.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|