C14H11N3O8S3 — CID 136729284
4,5-dihydroxy-6-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-disulfonic acid (PubChem CID 136729284) has the molecular formula C14H11N3O8S3 and a molecular weight of 445.46 g/mol. Its IUPAC name is 4,5-dihydroxy-6-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4,5-dihydroxy-6-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 136729284 |
| Molecular Formula | C14H11N3O8S3 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 4,5-dihydroxy-6-[(6-methyl-1,3-benzothiazol-2-yl)diazenyl]benzene-1,3-disulfonic acid |
| SMILES | Cc1ccc2nc(/N=N/c3c(S(=O)(=O)O)cc(S(=O)(=O)O)c(O)c3O)sc2c1 |
| InChI | InChI=1S/C14H11N3O8S3/c1-6-2-3-7-8(4-6)26-14(15-7)17-16-11-9(27(20,21)22)5-10(28(23,24)25)12(18)13(11)19/h2-5,18-19H,1H3,(H,20,21,22)(H,23,24,25)/b17-16+ |
| InChIKey | HIJCXHRCDFWWNX-WUKNDPDISA-N |
| XLogP | 2.92 |
| TPSA | 186.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|