C15H13N7O3S2 — CID 89331436
2-[[6-amino-5-cyano-4-methyl-2-(methylamino)-3-pyridinyl]diazenyl]-1,3-benzothiazole-6-sulfonic acid (PubChem CID 89331436) has the molecular formula C15H13N7O3S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-[[6-amino-5-cyano-4-methyl-2-(methylamino)-3-pyridinyl]diazenyl]-1,3-benzothiazole-6-sulfonic acid.
| Compound Name | 2-[[6-amino-5-cyano-4-methyl-2-(methylamino)-3-pyridinyl]diazenyl]-1,3-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 89331436 |
| Molecular Formula | C15H13N7O3S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2-[[6-amino-5-cyano-4-methyl-2-(methylamino)-3-pyridinyl]diazenyl]-1,3-benzothiazole-6-sulfonic acid |
| SMILES | CNc1nc(N)c(C#N)c(C)c1/N=N/c1nc2ccc(S(=O)(=O)O)cc2s1 |
| InChI | InChI=1S/C15H13N7O3S2/c1-7-9(6-16)13(17)20-14(18-2)12(7)21-22-15-19-10-4-3-8(27(23,24)25)5-11(10)26-15/h3-5H,1-2H3,(H3,17,18,20)(H,23,24,25)/b22-21+ |
| InChIKey | DADHQSRMOJKYHR-QURGRASLSA-N |
| XLogP | 3.16 |
| TPSA | 166.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|