C18H16N6O6S3 — CID 136502805
2-[[5-amino-3-methyl-1-(3-methyl-4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-6-sulfonic acid (PubChem CID 136502805) has the molecular formula C18H16N6O6S3 and a molecular weight of 508.56 g/mol. Its IUPAC name is 2-[[5-amino-3-methyl-1-(3-methyl-4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-6-sulfonic acid.
| Compound Name | 2-[[5-amino-3-methyl-1-(3-methyl-4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 136502805 |
| Molecular Formula | C18H16N6O6S3 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 2-[[5-amino-3-methyl-1-(3-methyl-4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-6-sulfonic acid |
| SMILES | Cc1cc(-n2nc(C)c(/N=N/c3nc4ccc(S(=O)(=O)O)cc4s3)c2N)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C18H16N6O6S3/c1-9-7-11(3-6-15(9)33(28,29)30)24-17(19)16(10(2)23-24)21-22-18-20-13-5-4-12(32(25,26)27)8-14(13)31-18/h3-8H,19H2,1-2H3,(H,25,26,27)(H,28,29,30)/b22-21+ |
| InChIKey | SYNZDULHFPEAQY-QURGRASLSA-N |
| XLogP | 3.59 |
| TPSA | 190.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|